C15H16Cl2N2O4 — CID 123420914
N-[3-(2,6-dichlorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123420914) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is N-[3-(2,6-dichlorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(2,6-dichlorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123420914 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[3-(2,6-dichlorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NCCCOc2c(Cl)cccc2Cl)C(=O)C1=O |
| InChI | InChI=1S/C15H16Cl2N2O4/c1-19-8-9(12(20)15(19)22)14(21)18-6-3-7-23-13-10(16)4-2-5-11(13)17/h2,4-5,9H,3,6-8H2,1H3,(H,18,21) |
| InChIKey | VBKOYWSLYSTBGW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|