C24H27Cl2N3O3 — CID 123837768
N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(N-methylanilino)propyl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123837768) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(N-methylanilino)propyl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(N-methylanilino)propyl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123837768 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(N-methylanilino)propyl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN(CCCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-28(18-8-3-2-4-9-18)13-6-14-29-16-19(22(30)24(29)32)23(31)27-12-5-7-17-10-11-20(25)21(26)15-17/h2-4,8-11,15,19H,5-7,12-14,16H2,1H3,(H,27,31) |
| InChIKey | AAJSCGULTVBLPD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|