C19H17Cl2N3O3 — CID 123925106
N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-pyridin-4-ylpyrrolidine-3-carboxamide (PubChem CID 123925106) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-pyridin-4-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-pyridin-4-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123925106 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-pyridin-4-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)C1CN(c2ccncc2)C(=O)C1=O |
| InChI | InChI=1S/C19H17Cl2N3O3/c20-15-4-3-12(10-16(15)21)2-1-7-23-18(26)14-11-24(19(27)17(14)25)13-5-8-22-9-6-13/h3-6,8-10,14H,1-2,7,11H2,(H,23,26) |
| InChIKey | FPLNXUPUKSQFIR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|