C18H20Cl2N2O3 — CID 71544458
1-cyclopropyl-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 71544458) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-cyclopropyl-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopropyl-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71544458 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-cyclopropyl-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CC(CCc1ccc(Cl)c(Cl)c1)NC(=O)C1CN(C2CC2)C(=O)C1=O |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-10(2-3-11-4-7-14(19)15(20)8-11)21-17(24)13-9-22(12-5-6-12)18(25)16(13)23/h4,7-8,10,12-13H,2-3,5-6,9H2,1H3,(H,21,24) |
| InChIKey | AWSGEOCJMAACNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|