C19H24Cl2N2O3 — CID 123893060
N-[3-(3,4-dichlorophenyl)propyl]-1-(2-methylbutyl)-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123893060) has the molecular formula C19H24Cl2N2O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-1-(2-methylbutyl)-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-1-(2-methylbutyl)-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123893060 |
| Molecular Formula | C19H24Cl2N2O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-1-(2-methylbutyl)-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CCC(C)CN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C(=O)C1=O |
| InChI | InChI=1S/C19H24Cl2N2O3/c1-3-12(2)10-23-11-14(17(24)19(23)26)18(25)22-8-4-5-13-6-7-15(20)16(21)9-13/h6-7,9,12,14H,3-5,8,10-11H2,1-2H3,(H,22,25) |
| InChIKey | AWLOERVDEJJYEL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|