C20H17BrCl2N2O3 — CID 71544340
1-(4-bromophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 71544340) has the molecular formula C20H17BrCl2N2O3 and a molecular weight of 484.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71544340 |
| Molecular Formula | C20H17BrCl2N2O3 |
| Molecular Weight | 484.18 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | 1-(4-bromophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)C1CN(c2ccc(Br)cc2)C(=O)C1=O |
| InChI | InChI=1S/C20H17BrCl2N2O3/c21-13-4-6-14(7-5-13)25-11-15(18(26)20(25)28)19(27)24-9-1-2-12-3-8-16(22)17(23)10-12/h3-8,10,15H,1-2,9,11H2,(H,24,27) |
| InChIKey | KWXKCEXRKVEJLX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|