C17H18Cl2N2O5 — CID 123627439
3-[4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoic acid (PubChem CID 123627439) has the molecular formula C17H18Cl2N2O5 and a molecular weight of 401.25 g/mol. Its IUPAC name is 3-[4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoic acid.
| Compound Name | 3-[4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 123627439 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-[4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C(=O)C1=O |
| InChI | InChI=1S/C17H18Cl2N2O5/c18-12-4-3-10(8-13(12)19)2-1-6-20-16(25)11-9-21(7-5-14(22)23)17(26)15(11)24/h3-4,8,11H,1-2,5-7,9H2,(H,20,25)(H,22,23) |
| InChIKey | BZNDHOSRIOYAGS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|