C18H19Cl2N3O6 — CID 91310424
2-[3-[4-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoylamino]acetic acid (PubChem CID 91310424) has the molecular formula C18H19Cl2N3O6 and a molecular weight of 444.27 g/mol. Its IUPAC name is 2-[3-[4-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoylamino]acetic acid.
| Compound Name | 2-[3-[4-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 91310424 |
| Molecular Formula | C18H19Cl2N3O6 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-[3-[4-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-2,3-dioxopyrrolidin-1-yl]propanoylamino]acetic acid |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C1CN(CCC(=O)NCC(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C18H19Cl2N3O6/c1-22(8-10-2-3-12(19)13(20)6-10)17(28)11-9-23(18(29)16(11)27)5-4-14(24)21-7-15(25)26/h2-3,6,11H,4-5,7-9H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | HVRCIIYIVWYCPP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|