C19H22Cl2N2O5 — CID 142849014
methyl 5-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]pentanoate (PubChem CID 142849014) has the molecular formula C19H22Cl2N2O5 and a molecular weight of 429.30 g/mol. Its IUPAC name is methyl 5-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]pentanoate |
|---|---|
| PubChem CID | 142849014 |
| Molecular Formula | C19H22Cl2N2O5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl 5-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1CC(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C19H22Cl2N2O5/c1-22(10-12-6-7-14(20)15(21)9-12)18(26)13-11-23(19(27)17(13)25)8-4-3-5-16(24)28-2/h6-7,9,25H,3-5,8,10-11H2,1-2H3 |
| InChIKey | ZRKDNDSQLSGSBN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|