C19H23Cl2N3O4 — CID 118014439
1-[2-[acetyl(methyl)amino]ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 118014439) has the molecular formula C19H23Cl2N3O4 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-[2-[acetyl(methyl)amino]ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | 1-[2-[acetyl(methyl)amino]ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 118014439 |
| Molecular Formula | C19H23Cl2N3O4 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-[2-[acetyl(methyl)amino]ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CC(=O)N(C)CCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C19H23Cl2N3O4/c1-12(25)23(2)8-9-24-11-14(17(26)19(24)28)18(27)22-7-3-4-13-5-6-15(20)16(21)10-13/h5-6,10,26H,3-4,7-9,11H2,1-2H3,(H,22,27) |
| InChIKey | CLZZAUJYZKZWKW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|