C23H24Cl2N2O3 — CID 90302376
N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-1-[(2S)-2-phenylpropyl]-2H-pyrrole-3-carboxamide (PubChem CID 90302376) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-1-[(2S)-2-phenylpropyl]-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-1-[(2S)-2-phenylpropyl]-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90302376 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-1-[(2S)-2-phenylpropyl]-2H-pyrrole-3-carboxamide |
| SMILES | C[C@H](CN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)=C(O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-15(17-7-3-2-4-8-17)13-27-14-18(21(28)23(27)30)22(29)26-11-5-6-16-9-10-19(24)20(25)12-16/h2-4,7-10,12,15,28H,5-6,11,13-14H2,1H3,(H,26,29)/t15-/m1/s1 |
| InChIKey | SARKKYDCHGYVTC-OAHLLOKOSA-N |
| XLogP | 4.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|