C21H18Cl2F2N2O3 — CID 89489324
N-[3-(3,4-dichlorophenyl)propyl]-1-[(2,6-difluorophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489324) has the molecular formula C21H18Cl2F2N2O3 and a molecular weight of 455.29 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-1-[(2,6-difluorophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[(2,6-difluorophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489324 |
| Molecular Formula | C21H18Cl2F2N2O3 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[(2,6-difluorophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)C1=C(O)C(=O)N(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C21H18Cl2F2N2O3/c22-15-7-6-12(9-16(15)23)3-2-8-26-20(29)14-11-27(21(30)19(14)28)10-13-17(24)4-1-5-18(13)25/h1,4-7,9,28H,2-3,8,10-11H2,(H,26,29) |
| InChIKey | WIQNADUFDHBETB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|