C24H24Cl2N2O4 — CID 90306376
N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[2-[4-(1-hydroxyethenyl)phenyl]ethyl]-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 90306376) has the molecular formula C24H24Cl2N2O4 and a molecular weight of 475.37 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[2-[4-(1-hydroxyethenyl)phenyl]ethyl]-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[2-[4-(1-hydroxyethenyl)phenyl]ethyl]-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90306376 |
| Molecular Formula | C24H24Cl2N2O4 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[2-[4-(1-hydroxyethenyl)phenyl]ethyl]-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | C=C(O)c1ccc(CCN2CC(C(=O)NCCCc3ccc(Cl)c(Cl)c3)=C(O)C2=O)cc1 |
| InChI | InChI=1S/C24H24Cl2N2O4/c1-15(29)18-7-4-16(5-8-18)10-12-28-14-19(22(30)24(28)32)23(31)27-11-2-3-17-6-9-20(25)21(26)13-17/h4-9,13,29-30H,1-3,10-12,14H2,(H,27,31) |
| InChIKey | JBQYXSCSIYVHKY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|