C22H21Cl3N2O3 — CID 89489384
1-[2-(2-chlorophenyl)ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489384) has the molecular formula C22H21Cl3N2O3 and a molecular weight of 467.78 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489384 |
| Molecular Formula | C22H21Cl3N2O3 |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)C1=C(O)C(=O)N(CCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H21Cl3N2O3/c23-17-6-2-1-5-15(17)9-11-27-13-16(20(28)22(27)30)21(29)26-10-3-4-14-7-8-18(24)19(25)12-14/h1-2,5-8,12,28H,3-4,9-11,13H2,(H,26,29) |
| InChIKey | VFRWQYWGMQHDKE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|