C21H19Cl3N2O3 — CID 89489304
2-(2-chlorophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489304) has the molecular formula C21H19Cl3N2O3 and a molecular weight of 453.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489304 |
| Molecular Formula | C21H19Cl3N2O3 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CN1C(=O)C(O)=C(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C1c1ccccc1Cl |
| InChI | InChI=1S/C21H19Cl3N2O3/c1-26-18(13-6-2-3-7-14(13)22)17(19(27)21(26)29)20(28)25-10-4-5-12-8-9-15(23)16(24)11-12/h2-3,6-9,11,18,27H,4-5,10H2,1H3,(H,25,28) |
| InChIKey | PXPCFJPTVIKQQG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|