C22H28Cl2N2O2 — CID 90306283
2-cyclohexyl-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide (PubChem CID 90306283) has the molecular formula C22H28Cl2N2O2 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-cyclohexyl-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide.
| Compound Name | 2-cyclohexyl-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90306283 |
| Molecular Formula | C22H28Cl2N2O2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-cyclohexyl-N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide |
| SMILES | C=C1C(O)=C(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C(C2CCCCC2)N1C |
| InChI | InChI=1S/C22H28Cl2N2O2/c1-14-21(27)19(20(26(14)2)16-8-4-3-5-9-16)22(28)25-12-6-7-15-10-11-17(23)18(24)13-15/h10-11,13,16,20,27H,1,3-9,12H2,2H3,(H,25,28) |
| InChIKey | IPJZRBOSLQZNOP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|