C22H21Cl2FN2O2 — CID 90306386
N-[3-(3,4-dichlorophenyl)propyl]-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide (PubChem CID 90306386) has the molecular formula C22H21Cl2FN2O2 and a molecular weight of 435.33 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90306386 |
| Molecular Formula | C22H21Cl2FN2O2 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-methylidene-2H-pyrrole-3-carboxamide |
| SMILES | C=C1C(O)=C(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C(c2ccc(F)cc2)N1C |
| InChI | InChI=1S/C22H21Cl2FN2O2/c1-13-21(28)19(20(27(13)2)15-6-8-16(25)9-7-15)22(29)26-11-3-4-14-5-10-17(23)18(24)12-14/h5-10,12,20,28H,1,3-4,11H2,2H3,(H,26,29) |
| InChIKey | RRLXWFPMBGJBDP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|