C18H20Cl2N2O3 — CID 71547881
N-[3-(3,4-dichlorophenyl)propyl]-5-hydroxy-1,2,3-trimethyl-6-oxopyridine-4-carboxamide (PubChem CID 71547881) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-5-hydroxy-1,2,3-trimethyl-6-oxopyridine-4-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-5-hydroxy-1,2,3-trimethyl-6-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 71547881 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-5-hydroxy-1,2,3-trimethyl-6-oxopyridine-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCc2ccc(Cl)c(Cl)c2)c(O)c(=O)n(C)c1C |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-10-11(2)22(3)18(25)16(23)15(10)17(24)21-8-4-5-12-6-7-13(19)14(20)9-12/h6-7,9,23H,4-5,8H2,1-3H3,(H,21,24) |
| InChIKey | SPKNURWDXATIRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|