C20H17Cl3N2O3 — CID 90355573
6-chloro-N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-8-methyl-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 90355573) has the molecular formula C20H17Cl3N2O3 and a molecular weight of 439.73 g/mol. Its IUPAC name is 6-chloro-N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-8-methyl-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-chloro-N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-8-methyl-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 90355573 |
| Molecular Formula | C20H17Cl3N2O3 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 6-chloro-N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-8-methyl-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | Cc1cc(Cl)cc2c(C(=O)NCCCc3ccc(Cl)c(Cl)c3)c(O)c(=O)[nH]c12 |
| InChI | InChI=1S/C20H17Cl3N2O3/c1-10-7-12(21)9-13-16(18(26)20(28)25-17(10)13)19(27)24-6-2-3-11-4-5-14(22)15(23)8-11/h4-5,7-9,26H,2-3,6H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | POPBGVAZJNLVDM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|