C21H17Cl2F3N2O5S — CID 90355540
[4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-1-methyl-2-oxoquinolin-3-yl] trifluoromethanesulfonate (PubChem CID 90355540) has the molecular formula C21H17Cl2F3N2O5S and a molecular weight of 537.34 g/mol. Its IUPAC name is [4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-1-methyl-2-oxoquinolin-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-1-methyl-2-oxoquinolin-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90355540 |
| Molecular Formula | C21H17Cl2F3N2O5S |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | [4-[3-(3,4-dichlorophenyl)propylcarbamoyl]-1-methyl-2-oxoquinolin-3-yl] trifluoromethanesulfonate |
| SMILES | Cn1c(=O)c(OS(=O)(=O)C(F)(F)F)c(C(=O)NCCCc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C21H17Cl2F3N2O5S/c1-28-16-7-3-2-6-13(16)17(18(20(28)30)33-34(31,32)21(24,25)26)19(29)27-10-4-5-12-8-9-14(22)15(23)11-12/h2-3,6-9,11H,4-5,10H2,1H3,(H,27,29) |
| InChIKey | XKAXYHKWFLNJNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|