C25H25Cl2N3O4 — CID 71547310
N-[3-(3,4-dichlorophenyl)propyl]-6-[4-(dimethylcarbamoyl)phenyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide (PubChem CID 71547310) has the molecular formula C25H25Cl2N3O4 and a molecular weight of 502.40 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-6-[4-(dimethylcarbamoyl)phenyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-6-[4-(dimethylcarbamoyl)phenyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 71547310 |
| Molecular Formula | C25H25Cl2N3O4 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-6-[4-(dimethylcarbamoyl)phenyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cc(C(=O)NCCCc3ccc(Cl)c(Cl)c3)c(O)c(=O)n2C)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O4/c1-29(2)24(33)17-9-7-16(8-10-17)21-14-18(22(31)25(34)30(21)3)23(32)28-12-4-5-15-6-11-19(26)20(27)13-15/h6-11,13-14,31H,4-5,12H2,1-3H3,(H,28,32) |
| InChIKey | ADMTUELNIKMOLB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|