C23H22Cl2N2O4 — CID 90342535
N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-1-(1-hydroxy-2-phenylethyl)-2-oxopyridine-4-carboxamide (PubChem CID 90342535) has the molecular formula C23H22Cl2N2O4 and a molecular weight of 461.35 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-1-(1-hydroxy-2-phenylethyl)-2-oxopyridine-4-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-1-(1-hydroxy-2-phenylethyl)-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 90342535 |
| Molecular Formula | C23H22Cl2N2O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-3-hydroxy-1-(1-hydroxy-2-phenylethyl)-2-oxopyridine-4-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)c1ccn(C(O)Cc2ccccc2)c(=O)c1O |
| InChI | InChI=1S/C23H22Cl2N2O4/c24-18-9-8-16(13-19(18)25)7-4-11-26-22(30)17-10-12-27(23(31)21(17)29)20(28)14-15-5-2-1-3-6-15/h1-3,5-6,8-10,12-13,20,28-29H,4,7,11,14H2,(H,26,30) |
| InChIKey | VZRAKNIWZRQMTH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|