About N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide
N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide (PubChem CID 71547967) has the molecular formula C18H20Cl2N2O3
and a molecular weight of 383.28 g/mol. Its IUPAC name is N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
| PubChem CID | 71547967 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
| SMILES | CC(CCCc1ccc(Cl)c(Cl)c1)NC(=O)c1ccn(C)c(=O)c1O |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-11(4-3-5-12-6-7-14(19)15(20)10-12)21-17(24)13-8-9-22(2)18(25)16(13)23/h6-11,23H,3-5H2,1-2H3,(H,21,24) |
| InChIKey | ZJXLZWIXCPVYQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide?
The IUPAC name of N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide (CID 71547967) is N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide.
What is the SMILES notation for N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide?
The canonical SMILES for N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide is CC(CCCc1ccc(Cl)c(Cl)c1)NC(=O)c1ccn(C)c(=O)c1O.
What is the InChIKey of N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide?
The InChIKey is ZJXLZWIXCPVYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2O3/c1-11(4-3-5-12-6-7-14(19)15(20)10-12)21-17(24)13-8-9-22(2)18(25)16(13)23/h6-11,23H,3-5H2,1-2H3,(H,21,24).
What are the key properties of N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide?
N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide has a molecular weight of 383.28 g/mol, XLogP of 3.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,4-dichlorophenyl)pentan-2-yl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide is sourced from PubChem (CID 71547967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).