C19H22Cl2N2O4 — CID 90306356
N-[4-(3,4-dichlorophenyl)butan-2-yl]-4-hydroxy-1-(3-hydroxybut-3-enyl)-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 90306356) has the molecular formula C19H22Cl2N2O4 and a molecular weight of 413.30 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)butan-2-yl]-4-hydroxy-1-(3-hydroxybut-3-enyl)-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)butan-2-yl]-4-hydroxy-1-(3-hydroxybut-3-enyl)-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90306356 |
| Molecular Formula | C19H22Cl2N2O4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)butan-2-yl]-4-hydroxy-1-(3-hydroxybut-3-enyl)-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | C=C(O)CCN1CC(C(=O)NC(C)CCc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C19H22Cl2N2O4/c1-11(3-4-13-5-6-15(20)16(21)9-13)22-18(26)14-10-23(8-7-12(2)24)19(27)17(14)25/h5-6,9,11,24-25H,2-4,7-8,10H2,1H3,(H,22,26) |
| InChIKey | PQZMAGKOZWBIPP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|