C21H29Cl2N3O3 — CID 89489429
N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(diethylamino)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489429) has the molecular formula C21H29Cl2N3O3 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(diethylamino)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(diethylamino)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489429 |
| Molecular Formula | C21H29Cl2N3O3 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[3-(diethylamino)propyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C21H29Cl2N3O3/c1-3-25(4-2)11-6-12-26-14-16(19(27)21(26)29)20(28)24-10-5-7-15-8-9-17(22)18(23)13-15/h8-9,13,27H,3-7,10-12,14H2,1-2H3,(H,24,28) |
| InChIKey | FZRILBYJSLQQGP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|