C21H28Cl2N2O3 — CID 158847179
N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-(5-methylhexyl)-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 158847179) has the molecular formula C21H28Cl2N2O3 and a molecular weight of 427.37 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-(5-methylhexyl)-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-(5-methylhexyl)-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 158847179 |
| Molecular Formula | C21H28Cl2N2O3 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-(5-methylhexyl)-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CC(C)CCCCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C21H28Cl2N2O3/c1-14(2)6-3-4-11-25-13-16(19(26)21(25)28)20(27)24-10-5-7-15-8-9-17(22)18(23)12-15/h8-9,12,14,26H,3-7,10-11,13H2,1-2H3,(H,24,27) |
| InChIKey | IYZBMTPVMDVHQF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|