C27H23F3N2O4S — CID 87756539
[2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 2,2,2-trifluoroethanesulfonate (PubChem CID 87756539) has the molecular formula C27H23F3N2O4S and a molecular weight of 528.55 g/mol. Its IUPAC name is [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 87756539 |
| Molecular Formula | C27H23F3N2O4S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 2,2,2-trifluoroethanesulfonate |
| SMILES | O=C(NCCCc1ccccc1)c1c(OS(=O)(=O)CC(F)(F)F)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H23F3N2O4S/c28-27(29,30)18-37(34,35)36-25-23(26(33)31-17-9-12-19-10-3-1-4-11-19)21-15-7-8-16-22(21)32-24(25)20-13-5-2-6-14-20/h1-8,10-11,13-16H,9,12,17-18H2,(H,31,33) |
| InChIKey | WONPIVXUIJEKJH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|