C27H26N2O2S — CID 69292079
3-(methylsulfinylmethyl)-2-phenyl-N-(3-phenylpropyl)quinoline-4-carboxamide (PubChem CID 69292079) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-(methylsulfinylmethyl)-2-phenyl-N-(3-phenylpropyl)quinoline-4-carboxamide.
| Compound Name | 3-(methylsulfinylmethyl)-2-phenyl-N-(3-phenylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 69292079 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-(methylsulfinylmethyl)-2-phenyl-N-(3-phenylpropyl)quinoline-4-carboxamide |
| SMILES | CS(=O)Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C27H26N2O2S/c1-32(31)19-23-25(27(30)28-18-10-13-20-11-4-2-5-12-20)22-16-8-9-17-24(22)29-26(23)21-14-6-3-7-15-21/h2-9,11-12,14-17H,10,13,18-19H2,1H3,(H,28,30) |
| InChIKey | LAHCBHBHFZFKEK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|