C41H31N3O4 — CID 54085349
[2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 3-hydroxy-2-phenylquinoline-4-carboxylate (PubChem CID 54085349) has the molecular formula C41H31N3O4 and a molecular weight of 629.72 g/mol. Its IUPAC name is [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 3-hydroxy-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 3-hydroxy-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 54085349 |
| Molecular Formula | C41H31N3O4 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | [2-phenyl-4-(3-phenylpropylcarbamoyl)quinolin-3-yl] 3-hydroxy-2-phenylquinoline-4-carboxylate |
| SMILES | O=C(Oc1c(-c2ccccc2)nc2ccccc2c1C(=O)NCCCc1ccccc1)c1c(O)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C41H31N3O4/c45-38-34(30-22-10-12-24-32(30)43-36(38)28-18-6-2-7-19-28)41(47)48-39-35(40(46)42-26-14-17-27-15-4-1-5-16-27)31-23-11-13-25-33(31)44-37(39)29-20-8-3-9-21-29/h1-13,15-16,18-25,45H,14,17,26H2,(H,42,46) |
| InChIKey | MQBHQRBCYHRCPR-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|