C36H28Cl2N4O2 — CID 4160455
2-(4-chlorophenyl)-N-[2-[[2-(4-chlorophenyl)-3-methylquinoline-4-carbonyl]amino]ethyl]-3-methylquinoline-4-carboxamide (PubChem CID 4160455) has the molecular formula C36H28Cl2N4O2 and a molecular weight of 619.55 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[[2-(4-chlorophenyl)-3-methylquinoline-4-carbonyl]amino]ethyl]-3-methylquinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[[2-(4-chlorophenyl)-3-methylquinoline-4-carbonyl]amino]ethyl]-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4160455 |
| Molecular Formula | C36H28Cl2N4O2 |
| Molecular Weight | 619.55 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[[2-(4-chlorophenyl)-3-methylquinoline-4-carbonyl]amino]ethyl]-3-methylquinoline-4-carboxamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2)nc2ccccc2c1C(=O)NCCNC(=O)c1c(C)c(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C36H28Cl2N4O2/c1-21-31(27-7-3-5-9-29(27)41-33(21)23-11-15-25(37)16-12-23)35(43)39-19-20-40-36(44)32-22(2)34(24-13-17-26(38)18-14-24)42-30-10-6-4-8-28(30)32/h3-18H,19-20H2,1-2H3,(H,39,43)(H,40,44) |
| InChIKey | FTFWOJOPLOYUBF-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.55 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|