C42H38Cl4N4O2 — CID 4245639
2-(2,4-dichlorophenyl)-N-[8-[[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino]octyl]-3-methylquinoline-4-carboxamide (PubChem CID 4245639) has the molecular formula C42H38Cl4N4O2 and a molecular weight of 772.60 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[8-[[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino]octyl]-3-methylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[8-[[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino]octyl]-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4245639 |
| Molecular Formula | C42H38Cl4N4O2 |
| Molecular Weight | 772.60 g/mol |
| Exact Mass | 770.17 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[8-[[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino]octyl]-3-methylquinoline-4-carboxamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2Cl)nc2ccccc2c1C(=O)NCCCCCCCCNC(=O)c1c(C)c(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C42H38Cl4N4O2/c1-25-37(31-13-7-9-15-35(31)49-39(25)29-19-17-27(43)23-33(29)45)41(51)47-21-11-5-3-4-6-12-22-48-42(52)38-26(2)40(30-20-18-28(44)24-34(30)46)50-36-16-10-8-14-32(36)38/h7-10,13-20,23-24H,3-6,11-12,21-22H2,1-2H3,(H,47,51)(H,48,52) |
| InChIKey | VTORGHDHSDPRQJ-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.60 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|