C23H20Cl2N4O — CID 3682044
2-(2,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methylquinoline-4-carboxamide (PubChem CID 3682044) has the molecular formula C23H20Cl2N4O and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3682044 |
| Molecular Formula | C23H20Cl2N4O |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methylquinoline-4-carboxamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2Cl)nc2ccccc2c1C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C23H20Cl2N4O/c1-15-21(23(30)27-9-4-11-29-12-10-26-14-29)18-5-2-3-6-20(18)28-22(15)17-8-7-16(24)13-19(17)25/h2-3,5-8,10,12-14H,4,9,11H2,1H3,(H,27,30) |
| InChIKey | JPLYJISAZPSOEL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|