C14H13ClN6O — CID 56730183
6-chloro-N-(3-imidazol-1-ylpropyl)-1,2,4-benzotriazine-3-carboxamide (PubChem CID 56730183) has the molecular formula C14H13ClN6O and a molecular weight of 316.75 g/mol. Its IUPAC name is 6-chloro-N-(3-imidazol-1-ylpropyl)-1,2,4-benzotriazine-3-carboxamide.
| Compound Name | 6-chloro-N-(3-imidazol-1-ylpropyl)-1,2,4-benzotriazine-3-carboxamide |
|---|---|
| PubChem CID | 56730183 |
| Molecular Formula | C14H13ClN6O |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 6-chloro-N-(3-imidazol-1-ylpropyl)-1,2,4-benzotriazine-3-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1nnc2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C14H13ClN6O/c15-10-2-3-11-12(8-10)18-13(20-19-11)14(22)17-4-1-6-21-7-5-16-9-21/h2-3,5,7-9H,1,4,6H2,(H,17,22) |
| InChIKey | AOQSGDFDHBKFDS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|