C16H21N3O5S — CID 90314977
1-ethyl-4-hydroxy-5-oxo-N-[3-(3-sulfamoylphenyl)propyl]-2H-pyrrole-3-carboxamide (PubChem CID 90314977) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-ethyl-4-hydroxy-5-oxo-N-[3-(3-sulfamoylphenyl)propyl]-2H-pyrrole-3-carboxamide.
| Compound Name | 1-ethyl-4-hydroxy-5-oxo-N-[3-(3-sulfamoylphenyl)propyl]-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90314977 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-ethyl-4-hydroxy-5-oxo-N-[3-(3-sulfamoylphenyl)propyl]-2H-pyrrole-3-carboxamide |
| SMILES | CCN1CC(C(=O)NCCCc2cccc(S(N)(=O)=O)c2)=C(O)C1=O |
| InChI | InChI=1S/C16H21N3O5S/c1-2-19-10-13(14(20)16(19)22)15(21)18-8-4-6-11-5-3-7-12(9-11)25(17,23)24/h3,5,7,9,20H,2,4,6,8,10H2,1H3,(H,18,21)(H2,17,23,24) |
| InChIKey | FIVSPMFWIOZCHJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|