C14H14Cl2N2O3 — CID 90923086
N-[(3,5-dichlorophenyl)methyl]-N,1-dimethyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 90923086) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-N,1-dimethyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-N,1-dimethyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90923086 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-N,1-dimethyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)N(C)Cc2cc(Cl)cc(Cl)c2)C(=O)C1=O |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-17(6-8-3-9(15)5-10(16)4-8)13(20)11-7-18(2)14(21)12(11)19/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | OHWNFFVIDIDWDC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|