C18H21Cl2N3O6S — CID 91068498
N-[(3,4-dichlorophenyl)methyl]-1-[4-(methanesulfonamido)-4-oxobutyl]-N-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 91068498) has the molecular formula C18H21Cl2N3O6S and a molecular weight of 478.35 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-1-[4-(methanesulfonamido)-4-oxobutyl]-N-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-1-[4-(methanesulfonamido)-4-oxobutyl]-N-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91068498 |
| Molecular Formula | C18H21Cl2N3O6S |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-1-[4-(methanesulfonamido)-4-oxobutyl]-N-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C1CN(CCCC(=O)NS(C)(=O)=O)C(=O)C1=O |
| InChI | InChI=1S/C18H21Cl2N3O6S/c1-22(9-11-5-6-13(19)14(20)8-11)17(26)12-10-23(18(27)16(12)25)7-3-4-15(24)21-30(2,28)29/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H,21,24) |
| InChIKey | JHFWDDCGUWGOSZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|