C23H24Cl2N2O4 — CID 123320002
N-[3-(3,4-dichlorophenyl)propyl]-1-[2-(4-methoxyphenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123320002) has the molecular formula C23H24Cl2N2O4 and a molecular weight of 463.36 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-1-[2-(4-methoxyphenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[2-(4-methoxyphenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123320002 |
| Molecular Formula | C23H24Cl2N2O4 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-1-[2-(4-methoxyphenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CCN2CC(C(=O)NCCCc3ccc(Cl)c(Cl)c3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O4/c1-31-17-7-4-15(5-8-17)10-12-27-14-18(21(28)23(27)30)22(29)26-11-2-3-16-6-9-19(24)20(25)13-16/h4-9,13,18H,2-3,10-12,14H2,1H3,(H,26,29) |
| InChIKey | JIUSIAULZHRGFV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|