C19H22Cl2N2O3 — CID 123183712
1-(cyclopropylmethyl)-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123183712) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123183712 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-N-[4-(3,4-dichlorophenyl)butan-2-yl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CC(CCc1ccc(Cl)c(Cl)c1)NC(=O)C1CN(CC2CC2)C(=O)C1=O |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-11(2-3-12-6-7-15(20)16(21)8-12)22-18(25)14-10-23(9-13-4-5-13)19(26)17(14)24/h6-8,11,13-14H,2-5,9-10H2,1H3,(H,22,25) |
| InChIKey | OQDUOFUMDXIXIP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|