C20H19Cl2N3O3 — CID 71544118
N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 71544118) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71544118 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4,5-dioxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)c(Cl)c1)C1CN(Cc2ccncc2)C(=O)C1=O |
| InChI | InChI=1S/C20H19Cl2N3O3/c21-16-4-3-13(10-17(16)22)2-1-7-24-19(27)15-12-25(20(28)18(15)26)11-14-5-8-23-9-6-14/h3-6,8-10,15H,1-2,7,11-12H2,(H,24,27) |
| InChIKey | FGOPJOVPTVAPAY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|