C19H26ClN3O5 — CID 123428327
1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[2-(4-chlorophenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123428327) has the molecular formula C19H26ClN3O5 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[2-(4-chlorophenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[2-(4-chlorophenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123428327 |
| Molecular Formula | C19H26ClN3O5 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[2-(4-chlorophenyl)ethyl]-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | NCCOCCOCCN1CC(C(=O)NCCc2ccc(Cl)cc2)C(=O)C1=O |
| InChI | InChI=1S/C19H26ClN3O5/c20-15-3-1-14(2-4-15)5-7-22-18(25)16-13-23(19(26)17(16)24)8-10-28-12-11-27-9-6-21/h1-4,16H,5-13,21H2,(H,22,25) |
| InChIKey | UZCQWKFUYIZYRY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|