C19H21N3O3 — CID 123869454
1-ethyl-4,5-dioxo-N-(3-quinolin-3-ylpropyl)pyrrolidine-3-carboxamide (PubChem CID 123869454) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-ethyl-4,5-dioxo-N-(3-quinolin-3-ylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-ethyl-4,5-dioxo-N-(3-quinolin-3-ylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123869454 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-ethyl-4,5-dioxo-N-(3-quinolin-3-ylpropyl)pyrrolidine-3-carboxamide |
| SMILES | CCN1CC(C(=O)NCCCc2cnc3ccccc3c2)C(=O)C1=O |
| InChI | InChI=1S/C19H21N3O3/c1-2-22-12-15(17(23)19(22)25)18(24)20-9-5-6-13-10-14-7-3-4-8-16(14)21-11-13/h3-4,7-8,10-11,15H,2,5-6,9,12H2,1H3,(H,20,24) |
| InChIKey | JRWSCRZOCBKKDK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|