C24H35N3O2 — CID 42797094
4-acetamido-N-octyl-N-(quinolin-3-ylmethyl)butanamide (PubChem CID 42797094) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 4-acetamido-N-octyl-N-(quinolin-3-ylmethyl)butanamide.
| Compound Name | 4-acetamido-N-octyl-N-(quinolin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 42797094 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 4-acetamido-N-octyl-N-(quinolin-3-ylmethyl)butanamide |
| SMILES | CCCCCCCCN(Cc1cnc2ccccc2c1)C(=O)CCCNC(C)=O |
| InChI | InChI=1S/C24H35N3O2/c1-3-4-5-6-7-10-16-27(24(29)14-11-15-25-20(2)28)19-21-17-22-12-8-9-13-23(22)26-18-21/h8-9,12-13,17-18H,3-7,10-11,14-16,19H2,1-2H3,(H,25,28) |
| InChIKey | PSZNQABPMRVXHW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|