About methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate
methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate (PubChem CID 123349111) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate.
Molecular Properties
| Compound Name | methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate |
| PubChem CID | 123349111 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCCNC(=O)C2CN(C)C(=O)C2=O)c1 |
| InChI | InChI=1S/C17H20N2O6/c1-19-10-13(14(20)16(19)22)15(21)18-7-4-8-25-12-6-3-5-11(9-12)17(23)24-2/h3,5-6,9,13H,4,7-8,10H2,1-2H3,(H,18,21) |
| InChIKey | KQLNESKWJKOPLR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate?
The IUPAC name of methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate (CID 123349111) is methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate.
What is the SMILES notation for methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate?
The canonical SMILES for methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate is COC(=O)c1cccc(OCCCNC(=O)C2CN(C)C(=O)C2=O)c1.
What is the InChIKey of methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate?
The InChIKey is KQLNESKWJKOPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O6/c1-19-10-13(14(20)16(19)22)15(21)18-7-4-8-25-12-6-3-5-11(9-12)17(23)24-2/h3,5-6,9,13H,4,7-8,10H2,1-2H3,(H,18,21).
What are the key properties of methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate?
methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate has a molecular weight of 348.36 g/mol, XLogP of 0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-[(1-methyl-4,5-dioxopyrrolidine-3-carbonyl)amino]propoxy]benzoate is sourced from PubChem (CID 123349111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).