C24H30N2O6S — CID 67244156
methyl 3-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]benzoate (PubChem CID 67244156) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is methyl 3-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]benzoate.
| Compound Name | methyl 3-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]benzoate |
|---|---|
| PubChem CID | 67244156 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | methyl 3-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCCNC2=C(c3ccccc3)S(O)(O)N(C(C)(C)C)C2=O)c1 |
| InChI | InChI=1S/C24H30N2O6S/c1-24(2,3)26-22(27)20(21(33(26,29)30)17-10-6-5-7-11-17)25-14-9-15-32-19-13-8-12-18(16-19)23(28)31-4/h5-8,10-13,16,25,29-30H,9,14-15H2,1-4H3 |
| InChIKey | VNKDQRNWCMBWSM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|