C22H23F3N2O5S — CID 67243696
2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[3-(trifluoromethoxy)phenoxy]ethylamino]-1,2-thiazol-3-one (PubChem CID 67243696) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[3-(trifluoromethoxy)phenoxy]ethylamino]-1,2-thiazol-3-one.
| Compound Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[3-(trifluoromethoxy)phenoxy]ethylamino]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 67243696 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[3-(trifluoromethoxy)phenoxy]ethylamino]-1,2-thiazol-3-one |
| SMILES | CC(C)(C)N1C(=O)C(NCCOc2cccc(OC(F)(F)F)c2)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C22H23F3N2O5S/c1-21(2,3)27-20(28)18(19(33(27,29)30)15-8-5-4-6-9-15)26-12-13-31-16-10-7-11-17(14-16)32-22(23,24)25/h4-11,14,26H,12-13H2,1-3H3 |
| InChIKey | NDMJQNFEFMDLQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|