C26H33N3O5S — CID 11627450
2-[4-[3-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]-N,N-dimethylacetamide (PubChem CID 11627450) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is 2-[4-[3-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[3-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 11627450 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[4-[3-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(OCCCNC2=C(c3ccccc3)S(=O)(=O)N(C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O5S/c1-26(2,3)29-25(31)23(24(35(29,32)33)20-10-7-6-8-11-20)27-16-9-17-34-21-14-12-19(13-15-21)18-22(30)28(4)5/h6-8,10-15,27H,9,16-18H2,1-5H3 |
| InChIKey | LNHOLZCRYLTKDN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|