C25H32N2O6S — CID 67243199
2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]propanoic acid (PubChem CID 67243199) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67243199 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(OCCCNC2=C(c3ccccc3)S(O)(O)N(C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C25H32N2O6S/c1-17(24(29)30)18-11-13-20(14-12-18)33-16-8-15-26-21-22(19-9-6-5-7-10-19)34(31,32)27(23(21)28)25(2,3)4/h5-7,9-14,17,26,31-32H,8,15-16H2,1-4H3,(H,29,30) |
| InChIKey | QBKODDBJOHCSQL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|