C24H30N2O6S — CID 67243671
2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]acetic acid (PubChem CID 67243671) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 67243671 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[4-[3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propoxy]phenyl]acetic acid |
| SMILES | CC(C)(C)N1C(=O)C(NCCCOc2ccc(CC(=O)O)cc2)=C(c2ccccc2)S1(O)O |
| InChI | InChI=1S/C24H30N2O6S/c1-24(2,3)26-23(29)21(22(33(26,30)31)18-8-5-4-6-9-18)25-14-7-15-32-19-12-10-17(11-13-19)16-20(27)28/h4-6,8-13,25,30-31H,7,14-16H2,1-3H3,(H,27,28) |
| InChIKey | SCRXRYOWHCFRQD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|