C19H17ClN2O4 — CID 71548529
N-[2-(2-chlorophenoxy)ethyl]-1-methyl-2,3-dioxo-4H-quinoline-4-carboxamide (PubChem CID 71548529) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-1-methyl-2,3-dioxo-4H-quinoline-4-carboxamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-1-methyl-2,3-dioxo-4H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71548529 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-1-methyl-2,3-dioxo-4H-quinoline-4-carboxamide |
| SMILES | CN1C(=O)C(=O)C(C(=O)NCCOc2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H17ClN2O4/c1-22-14-8-4-2-6-12(14)16(17(23)19(22)25)18(24)21-10-11-26-15-9-5-3-7-13(15)20/h2-9,16H,10-11H2,1H3,(H,21,24) |
| InChIKey | TYXGVVDMFDPZFB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|