C19H18F2N2O3 — CID 37362337
(3S)-N-[2-(4-fluorophenoxy)ethyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 37362337) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3S)-N-[2-(4-fluorophenoxy)ethyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(4-fluorophenoxy)ethyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 37362337 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3S)-N-[2-(4-fluorophenoxy)ethyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)[C@H]1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C19H18F2N2O3/c20-14-5-7-15(8-6-14)26-10-9-22-19(25)13-11-18(24)23(12-13)17-4-2-1-3-16(17)21/h1-8,13H,9-12H2,(H,22,25)/t13-/m0/s1 |
| InChIKey | IPGCYCFNQVJZHU-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|